C38H29F4N3O5S — CID 21386218
N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 21386218) has the molecular formula C38H29F4N3O5S and a molecular weight of 715.73 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 21386218 |
| Molecular Formula | C38H29F4N3O5S |
| Molecular Weight | 715.73 g/mol |
| Exact Mass | 715.18 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethoxyphenyl)-3-oxo-3-[4-[2-oxo-1-phenyl-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)Nc2ccc(SC(C(=O)Nc3c(F)c(F)cc(F)c3F)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C38H29F4N3O5S/c1-49-30-18-13-22(20-31(30)50-2)19-29(44-36(46)24-11-7-4-8-12-24)37(47)43-25-14-16-26(17-15-25)51-35(23-9-5-3-6-10-23)38(48)45-34-32(41)27(39)21-28(40)33(34)42/h3-21,35H,1-2H3,(H,43,47)(H,44,46)(H,45,48)/b29-19- |
| InChIKey | ADXTWDYPSUSVSO-CEUNXORHSA-N |
| XLogP | 8.14 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.73 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|