C43H34ClN3O4S — CID 22189332
N-[(Z)-3-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 22189332) has the molecular formula C43H34ClN3O4S and a molecular weight of 724.28 g/mol. Its IUPAC name is N-[(Z)-3-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22189332 |
| Molecular Formula | C43H34ClN3O4S |
| Molecular Weight | 724.28 g/mol |
| Exact Mass | 723.20 |
| IUPAC Name | N-[(Z)-3-[4-[2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccc(-c4ccccc4)cc3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C43H34ClN3O4S/c1-51-39-26-23-35(28-37(39)44)46-43(50)40(32-13-7-3-8-14-32)52-36-24-21-34(22-25-36)45-42(49)38(47-41(48)33-15-9-4-10-16-33)27-29-17-19-31(20-18-29)30-11-5-2-6-12-30/h2-28,40H,1H3,(H,45,49)(H,46,50)(H,47,48)/b38-27- |
| InChIKey | HOFGJBWLIYGTFC-SPKJYZRXSA-N |
| XLogP | 9.90 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.28 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|