C43H34N4O4S — CID 22189338
4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide (PubChem CID 22189338) has the molecular formula C43H34N4O4S and a molecular weight of 702.84 g/mol. Its IUPAC name is 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 22189338 |
| Molecular Formula | C43H34N4O4S |
| Molecular Weight | 702.84 g/mol |
| Exact Mass | 702.23 |
| IUPAC Name | 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccc(-c4ccccc4)cc3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H34N4O4S/c44-40(48)33-20-22-35(23-21-33)46-43(51)39(32-12-6-2-7-13-32)52-37-26-24-36(25-27-37)45-42(50)38(47-41(49)34-14-8-3-9-15-34)28-29-16-18-31(19-17-29)30-10-4-1-5-11-30/h1-28,39H,(H2,44,48)(H,45,50)(H,46,51)(H,47,49)/b38-28- |
| InChIKey | PAIQPUHYQAKZSO-AWYAZMPSSA-N |
| XLogP | 8.33 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.84 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|