C37H29N5O6S — CID 19311923
4-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide (PubChem CID 19311923) has the molecular formula C37H29N5O6S and a molecular weight of 671.74 g/mol. Its IUPAC name is 4-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide.
| Compound Name | 4-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 19311923 |
| Molecular Formula | C37H29N5O6S |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.18 |
| IUPAC Name | 4-[[2-[3-[[(E)-2-benzamido-3-(4-nitrophenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C37H29N5O6S/c38-34(43)26-16-18-28(19-17-26)39-37(46)33(25-8-3-1-4-9-25)49-31-13-7-12-29(23-31)40-36(45)32(41-35(44)27-10-5-2-6-11-27)22-24-14-20-30(21-15-24)42(47)48/h1-23,33H,(H2,38,43)(H,39,46)(H,40,45)(H,41,44)/b32-22+ |
| InChIKey | CZDZJMBSLBZAEE-WEMUVCOSSA-N |
| XLogP | 6.58 |
| TPSA | 173.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|