C37H23F7N4O5S — CID 19311922
N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19311922) has the molecular formula C37H23F7N4O5S and a molecular weight of 768.67 g/mol. Its IUPAC name is N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19311922 |
| Molecular Formula | C37H23F7N4O5S |
| Molecular Weight | 768.67 g/mol |
| Exact Mass | 768.13 |
| IUPAC Name | N-[(E)-1-(4-nitrophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c2ccccc2)c1)/C(=C\c1ccc([N+](=O)[O-])cc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H23F7N4O5S/c38-28-27(37(42,43)44)29(39)31(41)32(30(28)40)47-36(51)33(21-8-3-1-4-9-21)54-25-13-7-12-23(19-25)45-35(50)26(46-34(49)22-10-5-2-6-11-22)18-20-14-16-24(17-15-20)48(52)53/h1-19,33H,(H,45,50)(H,46,49)(H,47,51)/b26-18+ |
| InChIKey | GQIVXPXXZRVCMU-NLRVBDNBSA-N |
| XLogP | 9.05 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.67 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|