C40H30F7N3O6S — CID 19314514
N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314514) has the molecular formula C40H30F7N3O6S and a molecular weight of 813.75 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314514 |
| Molecular Formula | C40H30F7N3O6S |
| Molecular Weight | 813.75 g/mol |
| Exact Mass | 813.17 |
| IUPAC Name | N-[(E)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1cc(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3ccccc3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C40H30F7N3O6S/c1-54-27-18-21(19-28(55-2)35(27)56-3)17-26(49-37(51)23-13-8-5-9-14-23)38(52)48-24-15-10-16-25(20-24)57-36(22-11-6-4-7-12-22)39(53)50-34-32(43)30(41)29(40(45,46)47)31(42)33(34)44/h4-20,36H,1-3H3,(H,48,52)(H,49,51)(H,50,53)/b26-17+ |
| InChIKey | RKGYPGWPSQCELT-YZSQISJMSA-N |
| XLogP | 9.17 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.75 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|