C39H28F7N3O5S — CID 19308178
N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19308178) has the molecular formula C39H28F7N3O5S and a molecular weight of 783.72 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19308178 |
| Molecular Formula | C39H28F7N3O5S |
| Molecular Weight | 783.72 g/mol |
| Exact Mass | 783.16 |
| IUPAC Name | N-[(E)-1-(2,5-dimethoxyphenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C39H28F7N3O5S/c1-53-25-16-17-28(54-2)23(18-25)19-27(48-36(50)22-12-7-4-8-13-22)37(51)47-24-14-9-15-26(20-24)55-35(21-10-5-3-6-11-21)38(52)49-34-32(42)30(40)29(39(44,45)46)31(41)33(34)43/h3-20,35H,1-2H3,(H,47,51)(H,48,50)(H,49,52)/b27-19+ |
| InChIKey | CKCITPJHGOWVSD-ZXVVBBHZSA-N |
| XLogP | 9.16 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.72 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|