C39H34N4O6S — CID 19308180
2-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide (PubChem CID 19308180) has the molecular formula C39H34N4O6S and a molecular weight of 686.79 g/mol. Its IUPAC name is 2-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide.
| Compound Name | 2-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 19308180 |
| Molecular Formula | C39H34N4O6S |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | 2-[[2-[3-[[(E)-2-benzamido-3-(2,5-dimethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzamide |
| SMILES | COc1ccc(OC)c(/C=C(/NC(=O)c2ccccc2)C(=O)Nc2cccc(SC(C(=O)Nc3ccccc3C(N)=O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C39H34N4O6S/c1-48-29-20-21-34(49-2)27(22-29)23-33(43-37(45)26-14-7-4-8-15-26)38(46)41-28-16-11-17-30(24-28)50-35(25-12-5-3-6-13-25)39(47)42-32-19-10-9-18-31(32)36(40)44/h3-24,35H,1-2H3,(H2,40,44)(H,41,46)(H,42,47)(H,43,45)/b33-23+ |
| InChIKey | DIBNOWVBXCZQQA-GZZLJNBRSA-N |
| XLogP | 6.68 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|