C37H22Cl2F7N3O3S — CID 19307314
N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide (PubChem CID 19307314) has the molecular formula C37H22Cl2F7N3O3S and a molecular weight of 792.56 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307314 |
| Molecular Formula | C37H22Cl2F7N3O3S |
| Molecular Weight | 792.56 g/mol |
| Exact Mass | 791.06 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-oxo-3-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylanilino]prop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c2ccccc2)c1)/C(=C\c1c(Cl)cccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C37H22Cl2F7N3O3S/c38-24-15-8-16-25(39)23(24)18-26(48-34(50)20-11-5-2-6-12-20)35(51)47-21-13-7-14-22(17-21)53-33(19-9-3-1-4-10-19)36(52)49-32-30(42)28(40)27(37(44,45)46)29(41)31(32)43/h1-18,33H,(H,47,51)(H,48,50)(H,49,52)/b26-18+ |
| InChIKey | LRMOREDHHWAMFH-NLRVBDNBSA-N |
| XLogP | 10.45 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.56 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|