C36H26Cl2N4O5S — CID 19307274
N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19307274) has the molecular formula C36H26Cl2N4O5S and a molecular weight of 697.60 g/mol. Its IUPAC name is N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19307274 |
| Molecular Formula | C36H26Cl2N4O5S |
| Molecular Weight | 697.60 g/mol |
| Exact Mass | 696.10 |
| IUPAC Name | N-[(E)-1-(2,6-dichlorophenyl)-3-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc([N+](=O)[O-])cc2)c2ccccc2)c1)/C(=C\c1c(Cl)cccc1Cl)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C36H26Cl2N4O5S/c37-30-15-8-16-31(38)29(30)22-32(41-34(43)24-11-5-2-6-12-24)35(44)40-26-13-7-14-28(21-26)48-33(23-9-3-1-4-10-23)36(45)39-25-17-19-27(20-18-25)42(46)47/h1-22,33H,(H,39,45)(H,40,44)(H,41,43)/b32-22+ |
| InChIKey | ZAEJUNYCKSDVLO-WEMUVCOSSA-N |
| XLogP | 8.78 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.60 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|