C41H39N3O8S — CID 19314487
N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19314487) has the molecular formula C41H39N3O8S and a molecular weight of 733.84 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19314487 |
| Molecular Formula | C41H39N3O8S |
| Molecular Weight | 733.84 g/mol |
| Exact Mass | 733.25 |
| IUPAC Name | N-[(E)-3-[3-[2-(2,4-dimethoxyanilino)-2-oxo-1-phenylethyl]sulfanylanilino]-3-oxo-1-(3,4,5-trimethoxyphenyl)prop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3cc(OC)c(OC)c(OC)c3)NC(=O)c3ccccc3)c2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C41H39N3O8S/c1-48-30-19-20-32(34(25-30)49-2)43-41(47)38(27-13-8-6-9-14-27)53-31-18-12-17-29(24-31)42-40(46)33(44-39(45)28-15-10-7-11-16-28)21-26-22-35(50-3)37(52-5)36(23-26)51-4/h6-25,38H,1-5H3,(H,42,46)(H,43,47)(H,44,45)/b33-21+ |
| InChIKey | ABNFFFKXEYLGLZ-QNKGDIEWSA-N |
| XLogP | 7.61 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.84 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|