C38H26F7N3O3S — CID 19312570
N-[(E)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide (PubChem CID 19312570) has the molecular formula C38H26F7N3O3S and a molecular weight of 737.70 g/mol. Its IUPAC name is N-[(E)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19312570 |
| Molecular Formula | C38H26F7N3O3S |
| Molecular Weight | 737.70 g/mol |
| Exact Mass | 737.16 |
| IUPAC Name | N-[(E)-3-oxo-3-[3-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]-1-(4-phenylphenyl)prop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2ccc(-c3ccccc3)cc2)NC(=O)c2ccccc2)c1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C38H26F7N3O3S/c1-21(35(49)48-34-32(41)30(39)29(38(43,44)45)31(40)33(34)42)52-27-14-8-13-26(20-27)46-37(51)28(47-36(50)25-11-6-3-7-12-25)19-22-15-17-24(18-16-22)23-9-4-2-5-10-23/h2-21H,1H3,(H,46,51)(H,47,50)(H,48,49)/b28-19+ |
| InChIKey | GCENBRBYIINERR-TURZUDJPSA-N |
| XLogP | 9.46 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.70 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|