C33H26N6O5S2 — CID 19320658
N-[(E)-3-[3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19320658) has the molecular formula C33H26N6O5S2 and a molecular weight of 650.74 g/mol. Its IUPAC name is N-[(E)-3-[3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19320658 |
| Molecular Formula | C33H26N6O5S2 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | N-[(E)-3-[3-[2-[(5-methyl-1,3,4-thiadiazol-2-yl)amino]-2-oxo-1-phenylethyl]sulfanylanilino]-1-(4-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1nnc(NC(=O)C(Sc2cccc(NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)NC(=O)c3ccccc3)c2)c2ccccc2)s1 |
| InChI | InChI=1S/C33H26N6O5S2/c1-21-37-38-33(45-21)36-32(42)29(23-9-4-2-5-10-23)46-27-14-8-13-25(20-27)34-31(41)28(35-30(40)24-11-6-3-7-12-24)19-22-15-17-26(18-16-22)39(43)44/h2-20,29H,1H3,(H,34,41)(H,35,40)(H,36,38,42)/b28-19+ |
| InChIKey | JXQVNNREIMKGJW-TURZUDJPSA-N |
| XLogP | 6.64 |
| TPSA | 156.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|