C47H41N3O5S — CID 22189343
butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 22189343) has the molecular formula C47H41N3O5S and a molecular weight of 759.93 g/mol. Its IUPAC name is butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 22189343 |
| Molecular Formula | C47H41N3O5S |
| Molecular Weight | 759.93 g/mol |
| Exact Mass | 759.28 |
| IUPAC Name | butyl 4-[[2-[4-[[(Z)-2-benzamido-3-(4-phenylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(Sc2ccc(NC(=O)/C(=C/c3ccc(-c4ccccc4)cc3)NC(=O)c3ccccc3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H41N3O5S/c1-2-3-31-55-47(54)38-23-25-39(26-24-38)49-46(53)43(36-15-9-5-10-16-36)56-41-29-27-40(28-30-41)48-45(52)42(50-44(51)37-17-11-6-12-18-37)32-33-19-21-35(22-20-33)34-13-7-4-8-14-34/h4-30,32,43H,2-3,31H2,1H3,(H,48,52)(H,49,53)(H,50,51)/b42-32- |
| InChIKey | GAYXTLHQVCAKBT-LNVYXVJNSA-N |
| XLogP | 10.19 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.93 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|