C39H35N3O5S2 — CID 19313080
butyl 4-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate (PubChem CID 19313080) has the molecular formula C39H35N3O5S2 and a molecular weight of 689.86 g/mol. Its IUPAC name is butyl 4-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19313080 |
| Molecular Formula | C39H35N3O5S2 |
| Molecular Weight | 689.86 g/mol |
| Exact Mass | 689.20 |
| IUPAC Name | butyl 4-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)/C(=C/c3cccs3)NC(=O)c3ccccc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H35N3O5S2/c1-2-3-23-47-39(46)29-19-21-30(22-20-29)40-38(45)35(27-12-6-4-7-13-27)49-33-17-10-16-31(25-33)41-37(44)34(26-32-18-11-24-48-32)42-36(43)28-14-8-5-9-15-28/h4-22,24-26,35H,2-3,23H2,1H3,(H,40,45)(H,41,44)(H,42,43)/b34-26- |
| InChIKey | KBQYENCLIPUONR-CLIDGEQKSA-N |
| XLogP | 8.59 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.86 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|