C41H33N3O5S3 — CID 19053583
ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 19053583) has the molecular formula C41H33N3O5S3 and a molecular weight of 743.93 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19053583 |
| Molecular Formula | C41H33N3O5S3 |
| Molecular Weight | 743.93 g/mol |
| Exact Mass | 743.16 |
| IUPAC Name | ethyl 2-[[2-[3-[[(Z)-2-benzamido-3-thiophen-2-ylprop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C(Sc1cccc(NC(=O)/C(=C/c2cccs2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C41H33N3O5S3/c1-2-49-41(48)35-33(27-14-6-3-7-15-27)26-51-40(35)44-39(47)36(28-16-8-4-9-17-28)52-32-21-12-20-30(24-32)42-38(46)34(25-31-22-13-23-50-31)43-37(45)29-18-10-5-11-19-29/h3-26,36H,2H2,1H3,(H,42,46)(H,43,45)(H,44,47)/b34-25- |
| InChIKey | UENZHHWIBHAMFC-NQUVTRGKSA-N |
| XLogP | 9.53 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.93 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|