C40H37N3O6S2 — CID 19051966
ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-phenylthiophene-3-carboxylate (PubChem CID 19051966) has the molecular formula C40H37N3O6S2 and a molecular weight of 719.89 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 19051966 |
| Molecular Formula | C40H37N3O6S2 |
| Molecular Weight | 719.89 g/mol |
| Exact Mass | 719.21 |
| IUPAC Name | ethyl 2-[2-[3-[[(Z)-2-benzamido-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylbutanoylamino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)C(CC)Sc1cccc(NC(=O)/C(=C/c2cccc(OC)c2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C40H37N3O6S2/c1-4-34(38(46)43-39-35(40(47)49-5-2)32(25-50-39)27-15-8-6-9-16-27)51-31-21-13-19-29(24-31)41-37(45)33(23-26-14-12-20-30(22-26)48-3)42-36(44)28-17-10-7-11-18-28/h6-25,34H,4-5H2,1-3H3,(H,41,45)(H,42,44)(H,43,46)/b33-23- |
| InChIKey | VZAVSHPELHOGSM-SNCSUOKWSA-N |
| XLogP | 8.52 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.89 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|