C45H39N3O5S2 — CID 19053845
ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19053845) has the molecular formula C45H39N3O5S2 and a molecular weight of 765.96 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19053845 |
| Molecular Formula | C45H39N3O5S2 |
| Molecular Weight | 765.96 g/mol |
| Exact Mass | 765.23 |
| IUPAC Name | ethyl 2-[[2-[3-[[(E)-2-benzamido-3-(3-methylphenyl)prop-2-enoyl]amino]phenyl]sulfanyl-2-phenylacetyl]amino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(Sc1cccc(NC(=O)/C(=C\c2cccc(C)c2)NC(=O)c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C45H39N3O5S2/c1-4-53-45(52)39-37(32-23-21-29(2)22-24-32)28-54-44(39)48-43(51)40(33-15-7-5-8-16-33)55-36-20-12-19-35(27-36)46-42(50)38(26-31-14-11-13-30(3)25-31)47-41(49)34-17-9-6-10-18-34/h5-28,40H,4H2,1-3H3,(H,46,50)(H,47,49)(H,48,51)/b38-26+ |
| InChIKey | UKLUXFDQOKCRBW-DZTJYMNTSA-N |
| XLogP | 10.09 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.96 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|