C38H33N3O5S2 — CID 19321701
methyl 2-[2-[3-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19321701) has the molecular formula C38H33N3O5S2 and a molecular weight of 675.83 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19321701 |
| Molecular Formula | C38H33N3O5S2 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.19 |
| IUPAC Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-phenylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C/c2ccccc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C38H33N3O5S2/c1-24-17-19-27(20-18-24)31-23-47-37(33(31)38(45)46-3)41-34(42)25(2)48-30-16-10-15-29(22-30)39-36(44)32(21-26-11-6-4-7-12-26)40-35(43)28-13-8-5-9-14-28/h4-23,25H,1-3H3,(H,39,44)(H,40,43)(H,41,42)/b32-21- |
| InChIKey | DGNKUKXSNVLELZ-QXPFVDMISA-N |
| XLogP | 8.04 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|