C36H31N3O5S3 — CID 19053085
methyl 2-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19053085) has the molecular formula C36H31N3O5S3 and a molecular weight of 681.86 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19053085 |
| Molecular Formula | C36H31N3O5S3 |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.14 |
| IUPAC Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-thiophen-3-ylprop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C/c2ccsc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C36H31N3O5S3/c1-22-12-14-25(15-13-22)29-21-46-35(31(29)36(43)44-3)39-32(40)23(2)47-28-11-7-10-27(19-28)37-34(42)30(18-24-16-17-45-20-24)38-33(41)26-8-5-4-6-9-26/h4-21,23H,1-3H3,(H,37,42)(H,38,41)(H,39,40)/b30-18- |
| InChIKey | IEDFATRTNMWSOF-YKQZZPSBSA-N |
| XLogP | 8.10 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|