C45H39N3O6S2 — CID 19054273
methyl 2-[2-[3-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19054273) has the molecular formula C45H39N3O6S2 and a molecular weight of 781.96 g/mol. Its IUPAC name is methyl 2-[2-[3-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054273 |
| Molecular Formula | C45H39N3O6S2 |
| Molecular Weight | 781.96 g/mol |
| Exact Mass | 781.23 |
| IUPAC Name | methyl 2-[2-[3-[[(Z)-2-benzamido-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C45H39N3O6S2/c1-29-17-21-33(22-18-29)38-28-55-44(40(38)45(52)53-3)48-41(49)30(2)56-37-16-10-15-35(26-37)46-43(51)39(47-42(50)34-13-8-5-9-14-34)25-31-19-23-36(24-20-31)54-27-32-11-6-4-7-12-32/h4-26,28,30H,27H2,1-3H3,(H,46,51)(H,47,50)(H,48,49)/b39-25- |
| InChIKey | PYYHBLKPGTVJDU-BZFSWPTRSA-N |
| XLogP | 9.62 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.96 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|