C39H34BrN3O5S2 — CID 19054406
ethyl 2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19054406) has the molecular formula C39H34BrN3O5S2 and a molecular weight of 768.76 g/mol. Its IUPAC name is ethyl 2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19054406 |
| Molecular Formula | C39H34BrN3O5S2 |
| Molecular Weight | 768.76 g/mol |
| Exact Mass | 767.11 |
| IUPAC Name | ethyl 2-[2-[3-[[(E)-2-benzamido-3-(3-bromophenyl)prop-2-enoyl]amino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=O)/C(=C\c2cccc(Br)c2)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C39H34BrN3O5S2/c1-4-48-39(47)34-32(27-18-16-24(2)17-19-27)23-49-38(34)43-35(44)25(3)50-31-15-9-14-30(22-31)41-37(46)33(21-26-10-8-13-29(40)20-26)42-36(45)28-11-6-5-7-12-28/h5-23,25H,4H2,1-3H3,(H,41,46)(H,42,45)(H,43,44)/b33-21+ |
| InChIKey | DKRVLLFXMXLDJW-QNKGDIEWSA-N |
| XLogP | 9.19 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.76 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|