C31H30N2O4S2 — CID 18910970
ethyl 4-(4-methylphenyl)-2-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanoylamino]thiophene-3-carboxylate (PubChem CID 18910970) has the molecular formula C31H30N2O4S2 and a molecular weight of 558.73 g/mol. Its IUPAC name is ethyl 4-(4-methylphenyl)-2-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanoylamino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(4-methylphenyl)-2-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 18910970 |
| Molecular Formula | C31H30N2O4S2 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | ethyl 4-(4-methylphenyl)-2-[2-[3-[(2-phenylacetyl)amino]phenyl]sulfanylpropanoylamino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C31H30N2O4S2/c1-4-37-31(36)28-26(23-15-13-20(2)14-16-23)19-38-30(28)33-29(35)21(3)39-25-12-8-11-24(18-25)32-27(34)17-22-9-6-5-7-10-22/h5-16,18-19,21H,4,17H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | LRRCIKHROOOIKZ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|