C32H31N3O4S3 — CID 19317880
ethyl 2-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate (PubChem CID 19317880) has the molecular formula C32H31N3O4S3 and a molecular weight of 617.82 g/mol. Its IUPAC name is ethyl 2-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19317880 |
| Molecular Formula | C32H31N3O4S3 |
| Molecular Weight | 617.82 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | ethyl 2-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]-4-(4-methylphenyl)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2)csc1NC(=O)C(C)Sc1cccc(NC(=S)Nc2ccc(C(C)=O)cc2)c1 |
| InChI | InChI=1S/C32H31N3O4S3/c1-5-39-31(38)28-27(23-11-9-19(2)10-12-23)18-41-30(28)35-29(37)21(4)42-26-8-6-7-25(17-26)34-32(40)33-24-15-13-22(14-16-24)20(3)36/h6-18,21H,5H2,1-4H3,(H,35,37)(H2,33,34,40) |
| InChIKey | MJMLWEIUSXMDQG-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.82 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|