C28H31N3O3S2 — CID 19316608
butyl 4-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoate (PubChem CID 19316608) has the molecular formula C28H31N3O3S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is butyl 4-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoate.
| Compound Name | butyl 4-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoate |
|---|---|
| PubChem CID | 19316608 |
| Molecular Formula | C28H31N3O3S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | butyl 4-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C(C)Sc2cccc(NC(=S)Nc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C28H31N3O3S2/c1-4-5-17-34-27(33)21-11-15-22(16-12-21)29-26(32)20(3)36-25-8-6-7-24(18-25)31-28(35)30-23-13-9-19(2)10-14-23/h6-16,18,20H,4-5,17H2,1-3H3,(H,29,32)(H2,30,31,35) |
| InChIKey | KQXRKBLSWNMRIH-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|