C24H22ClN3O3S2 — CID 19316593
2-chloro-5-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 19316593) has the molecular formula C24H22ClN3O3S2 and a molecular weight of 500.05 g/mol. Its IUPAC name is 2-chloro-5-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 2-chloro-5-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 19316593 |
| Molecular Formula | C24H22ClN3O3S2 |
| Molecular Weight | 500.05 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 2-chloro-5-[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | Cc1ccc(NC(=S)Nc2cccc(SC(C)C(=O)Nc3ccc(Cl)c(C(=O)O)c3)c2)cc1 |
| InChI | InChI=1S/C24H22ClN3O3S2/c1-14-6-8-16(9-7-14)27-24(32)28-17-4-3-5-19(12-17)33-15(2)22(29)26-18-10-11-21(25)20(13-18)23(30)31/h3-13,15H,1-2H3,(H,26,29)(H,30,31)(H2,27,28,32) |
| InChIKey | ITBBXBKPEAEJBG-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.05 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|