C24H24ClN3OS2 — CID 19316550
N-(3-chloro-4-methylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide (PubChem CID 19316550) has the molecular formula C24H24ClN3OS2 and a molecular weight of 470.06 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316550 |
| Molecular Formula | C24H24ClN3OS2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylpropanamide |
| SMILES | Cc1ccc(NC(=S)Nc2cccc(SC(C)C(=O)Nc3ccc(C)c(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C24H24ClN3OS2/c1-15-7-10-18(11-8-15)27-24(30)28-19-5-4-6-21(13-19)31-17(3)23(29)26-20-12-9-16(2)22(25)14-20/h4-14,17H,1-3H3,(H,26,29)(H2,27,28,30) |
| InChIKey | XNXHFEQWQKIHRZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|