C25H23N3O4S2 — CID 19317171
4-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 19317171) has the molecular formula C25H23N3O4S2 and a molecular weight of 493.61 g/mol. Its IUPAC name is 4-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 4-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 19317171 |
| Molecular Formula | C25H23N3O4S2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 4-[2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C)C(=O)Nc3ccc(C(=O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C25H23N3O4S2/c1-15(29)17-6-10-20(11-7-17)27-25(33)28-21-4-3-5-22(14-21)34-16(2)23(30)26-19-12-8-18(9-13-19)24(31)32/h3-14,16H,1-2H3,(H,26,30)(H,31,32)(H2,27,28,33) |
| InChIKey | ZFBGNYHHHYSZTF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|