C21H22N2O3S — CID 18901250
N-[3-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide (PubChem CID 18901250) has the molecular formula C21H22N2O3S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[3-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 18901250 |
| Molecular Formula | C21H22N2O3S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N-[3-[1-(4-acetylanilino)-1-oxopropan-2-yl]sulfanylphenyl]cyclopropanecarboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(C)Sc2cccc(NC(=O)C3CC3)c2)cc1 |
| InChI | InChI=1S/C21H22N2O3S/c1-13(24)15-8-10-17(11-9-15)22-20(25)14(2)27-19-5-3-4-18(12-19)23-21(26)16-6-7-16/h3-5,8-12,14,16H,6-7H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | MHBFZZFJBNGTRY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |