C26H25N3O4S2 — CID 19317185
2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide (PubChem CID 19317185) has the molecular formula C26H25N3O4S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide.
| Compound Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide |
|---|---|
| PubChem CID | 19317185 |
| Molecular Formula | C26H25N3O4S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 2-[3-[(4-acetylphenyl)carbamothioylamino]phenyl]sulfanyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)propanamide |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2cccc(SC(C)C(=O)Nc3ccc4c(c3)OCCO4)c2)cc1 |
| InChI | InChI=1S/C26H25N3O4S2/c1-16(30)18-6-8-19(9-7-18)28-26(34)29-20-4-3-5-22(14-20)35-17(2)25(31)27-21-10-11-23-24(15-21)33-13-12-32-23/h3-11,14-15,17H,12-13H2,1-2H3,(H,27,31)(H2,28,29,34) |
| InChIKey | DNRBMQDUXYDPMJ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|