C23H21N3O3S2 — CID 19316322
N-(1,3-benzodioxol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide (PubChem CID 19316322) has the molecular formula C23H21N3O3S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316322 |
| Molecular Formula | C23H21N3O3S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
| SMILES | CC(Sc1cccc(NC(=S)Nc2ccccc2)c1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H21N3O3S2/c1-15(22(27)24-18-10-11-20-21(13-18)29-14-28-20)31-19-9-5-8-17(12-19)26-23(30)25-16-6-3-2-4-7-16/h2-13,15H,14H2,1H3,(H,24,27)(H2,25,26,30) |
| InChIKey | ADERWLLBAVDCPF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|