C23H23N3O2S2 — CID 19316292
N-(3-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide (PubChem CID 19316292) has the molecular formula C23H23N3O2S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide.
| Compound Name | N-(3-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 19316292 |
| Molecular Formula | C23H23N3O2S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[3-(phenylcarbamothioylamino)phenyl]sulfanylpropanamide |
| SMILES | COc1cccc(NC(=O)C(C)Sc2cccc(NC(=S)Nc3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H23N3O2S2/c1-16(22(27)24-18-10-6-12-20(14-18)28-2)30-21-13-7-11-19(15-21)26-23(29)25-17-8-4-3-5-9-17/h3-16H,1-2H3,(H,24,27)(H2,25,26,29) |
| InChIKey | OFJHILGXJMOFFD-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|