C24H22N2O5S — CID 18903290
4-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid (PubChem CID 18903290) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is 4-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid.
| Compound Name | 4-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid |
|---|---|
| PubChem CID | 18903290 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-[2-[3-[(3-methoxybenzoyl)amino]phenyl]sulfanylpropanoylamino]benzoic acid |
| SMILES | COc1cccc(C(=O)Nc2cccc(SC(C)C(=O)Nc3ccc(C(=O)O)cc3)c2)c1 |
| InChI | InChI=1S/C24H22N2O5S/c1-15(22(27)25-18-11-9-16(10-12-18)24(29)30)32-21-8-4-6-19(14-21)26-23(28)17-5-3-7-20(13-17)31-2/h3-15H,1-2H3,(H,25,27)(H,26,28)(H,29,30) |
| InChIKey | OYJXYWRIIGMXAR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |