C32H26N2O3S — CID 18903484
3-methoxy-N-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 18903484) has the molecular formula C32H26N2O3S and a molecular weight of 518.64 g/mol. Its IUPAC name is 3-methoxy-N-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 3-methoxy-N-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18903484 |
| Molecular Formula | C32H26N2O3S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 3-methoxy-N-[3-[2-(naphthalen-2-ylamino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | COc1cccc(C(=O)Nc2cccc(SC(C(=O)Nc3ccc4ccccc4c3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C32H26N2O3S/c1-37-28-15-7-13-25(20-28)31(35)33-26-14-8-16-29(21-26)38-30(23-10-3-2-4-11-23)32(36)34-27-18-17-22-9-5-6-12-24(22)19-27/h2-21,30H,1H3,(H,33,35)(H,34,36) |
| InChIKey | OQCGADPWRQKLQA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |