C30H28N2O4S — CID 18903501
N-[3-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methoxybenzamide (PubChem CID 18903501) has the molecular formula C30H28N2O4S and a molecular weight of 512.63 g/mol. Its IUPAC name is N-[3-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methoxybenzamide.
| Compound Name | N-[3-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 18903501 |
| Molecular Formula | C30H28N2O4S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[3-[2-(4-ethoxyanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methoxybenzamide |
| SMILES | CCOc1ccc(NC(=O)C(Sc2cccc(NC(=O)c3cccc(OC)c3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O4S/c1-3-36-25-17-15-23(16-18-25)31-30(34)28(21-9-5-4-6-10-21)37-27-14-8-12-24(20-27)32-29(33)22-11-7-13-26(19-22)35-2/h4-20,28H,3H2,1-2H3,(H,31,34)(H,32,33) |
| InChIKey | GRBXCCRRSTUVSO-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |