C29H24N2O5S — CID 18903794
4-[[2-[3-[(4-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid (PubChem CID 18903794) has the molecular formula C29H24N2O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is 4-[[2-[3-[(4-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[3-[(4-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 18903794 |
| Molecular Formula | C29H24N2O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 4-[[2-[3-[(4-methoxybenzoyl)amino]phenyl]sulfanyl-2-phenylacetyl]amino]benzoic acid |
| SMILES | COc1ccc(C(=O)Nc2cccc(SC(C(=O)Nc3ccc(C(=O)O)cc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H24N2O5S/c1-36-24-16-12-20(13-17-24)27(32)31-23-8-5-9-25(18-23)37-26(19-6-3-2-4-7-19)28(33)30-22-14-10-21(11-15-22)29(34)35/h2-18,26H,1H3,(H,30,33)(H,31,32)(H,34,35) |
| InChIKey | CVVQNVBKPHEOTA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |