C29H26N2O3S — CID 18903762
4-methoxy-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 18903762) has the molecular formula C29H26N2O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is 4-methoxy-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-methoxy-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18903762 |
| Molecular Formula | C29H26N2O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 4-methoxy-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(SC(C(=O)Nc3ccccc3C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H26N2O3S/c1-20-9-6-7-14-26(20)31-29(33)27(21-10-4-3-5-11-21)35-25-13-8-12-23(19-25)30-28(32)22-15-17-24(34-2)18-16-22/h3-19,27H,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | KJHSVVBAQHYJQM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |