C29H26N2O2S — CID 18907218
4-methyl-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide (PubChem CID 18907218) has the molecular formula C29H26N2O2S and a molecular weight of 466.61 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-methyl-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18907218 |
| Molecular Formula | C29H26N2O2S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 4-methyl-N-[3-[2-(2-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(SC(C(=O)Nc3ccccc3C)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H26N2O2S/c1-20-15-17-23(18-16-20)28(32)30-24-12-8-13-25(19-24)34-27(22-10-4-3-5-11-22)29(33)31-26-14-7-6-9-21(26)2/h3-19,27H,1-2H3,(H,30,32)(H,31,33) |
| InChIKey | DJYZMQVUNUFTLO-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |