C28H25N3O4S2 — CID 18907255
4-methyl-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide (PubChem CID 18907255) has the molecular formula C28H25N3O4S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide.
| Compound Name | 4-methyl-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 18907255 |
| Molecular Formula | C28H25N3O4S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 4-methyl-N-[3-[2-oxo-1-phenyl-2-(4-sulfamoylanilino)ethyl]sulfanylphenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(SC(C(=O)Nc3ccc(S(N)(=O)=O)cc3)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H25N3O4S2/c1-19-10-12-21(13-11-19)27(32)31-23-8-5-9-24(18-23)36-26(20-6-3-2-4-7-20)28(33)30-22-14-16-25(17-15-22)37(29,34)35/h2-18,26H,1H3,(H,30,33)(H,31,32)(H2,29,34,35) |
| InChIKey | OJVBXKPRZMEQNS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |