C29H23FN2O3S — CID 18904346
N-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide (PubChem CID 18904346) has the molecular formula C29H23FN2O3S and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 18904346 |
| Molecular Formula | C29H23FN2O3S |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | N-[3-[2-(4-acetylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-fluorobenzamide |
| SMILES | CC(=O)c1ccc(NC(=O)C(Sc2cccc(NC(=O)c3ccc(F)cc3)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23FN2O3S/c1-19(33)20-12-16-24(17-13-20)31-29(35)27(21-6-3-2-4-7-21)36-26-9-5-8-25(18-26)32-28(34)22-10-14-23(30)15-11-22/h2-18,27H,1H3,(H,31,35)(H,32,34) |
| InChIKey | IMBJYSAFCIGBBP-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |