C28H23FN2O2S — CID 18906951
N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide (PubChem CID 18906951) has the molecular formula C28H23FN2O2S and a molecular weight of 470.57 g/mol. Its IUPAC name is N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 18906951 |
| Molecular Formula | C28H23FN2O2S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cccc(SC(C(=O)Nc3ccc(F)cc3)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H23FN2O2S/c1-19-7-5-10-21(17-19)27(32)31-24-11-6-12-25(18-24)34-26(20-8-3-2-4-9-20)28(33)30-23-15-13-22(29)14-16-23/h2-18,26H,1H3,(H,30,33)(H,31,32) |
| InChIKey | LZJSITLHUWEYQA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |