C31H30N2O2S — CID 18906949
N-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide (PubChem CID 18906949) has the molecular formula C31H30N2O2S and a molecular weight of 494.66 g/mol. Its IUPAC name is N-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 18906949 |
| Molecular Formula | C31H30N2O2S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-[3-[2-(2-ethyl-6-methylanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide |
| SMILES | CCc1cccc(C)c1NC(=O)C(Sc1cccc(NC(=O)c2cccc(C)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C31H30N2O2S/c1-4-23-15-9-12-22(3)28(23)33-31(35)29(24-13-6-5-7-14-24)36-27-18-10-17-26(20-27)32-30(34)25-16-8-11-21(2)19-25/h5-20,29H,4H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | GAUYKAOAPBKISI-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |