C28H23BrN2O2S — CID 18906909
N-[3-[2-(2-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide (PubChem CID 18906909) has the molecular formula C28H23BrN2O2S and a molecular weight of 531.48 g/mol. Its IUPAC name is N-[3-[2-(2-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide.
| Compound Name | N-[3-[2-(2-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 18906909 |
| Molecular Formula | C28H23BrN2O2S |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | N-[3-[2-(2-bromoanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2cccc(SC(C(=O)Nc3ccccc3Br)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C28H23BrN2O2S/c1-19-9-7-12-21(17-19)27(32)30-22-13-8-14-23(18-22)34-26(20-10-3-2-4-11-20)28(33)31-25-16-6-5-15-24(25)29/h2-18,26H,1H3,(H,30,32)(H,31,33) |
| InChIKey | LMJALPZMVUGPLU-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |