C27H20FN3O4S — CID 18905511
N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide (PubChem CID 18905511) has the molecular formula C27H20FN3O4S and a molecular weight of 501.54 g/mol. Its IUPAC name is N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide.
| Compound Name | N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 18905511 |
| Molecular Formula | C27H20FN3O4S |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | N-[3-[2-(4-fluoroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(F)cc2)c2ccccc2)c1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H20FN3O4S/c28-20-11-13-21(14-12-20)29-27(33)25(18-5-2-1-3-6-18)36-24-8-4-7-22(17-24)30-26(32)19-9-15-23(16-10-19)31(34)35/h1-17,25H,(H,29,33)(H,30,32) |
| InChIKey | JGXOFUNIJLCWGV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|