C25H19N3O5S — CID 18904625
N-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 18904625) has the molecular formula C25H19N3O5S and a molecular weight of 473.51 g/mol. Its IUPAC name is N-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18904625 |
| Molecular Formula | C25H19N3O5S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[3-[2-(4-nitroanilino)-2-oxo-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc([N+](=O)[O-])cc2)c2ccccc2)c1)c1ccco1 |
| InChI | InChI=1S/C25H19N3O5S/c29-24(22-10-5-15-33-22)27-19-8-4-9-21(16-19)34-23(17-6-2-1-3-7-17)25(30)26-18-11-13-20(14-12-18)28(31)32/h1-16,23H,(H,26,30)(H,27,29) |
| InChIKey | LNBZEHOVEFABIL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|