C26H15F7N2O3S — CID 18904665
N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 18904665) has the molecular formula C26H15F7N2O3S and a molecular weight of 568.47 g/mol. Its IUPAC name is N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18904665 |
| Molecular Formula | C26H15F7N2O3S |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 568.07 |
| IUPAC Name | N-[3-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c2ccccc2)c1)c1ccco1 |
| InChI | InChI=1S/C26H15F7N2O3S/c27-18-17(26(31,32)33)19(28)21(30)22(20(18)29)35-25(37)23(13-6-2-1-3-7-13)39-15-9-4-8-14(12-15)34-24(36)16-10-5-11-38-16/h1-12,23H,(H,34,36)(H,35,37) |
| InChIKey | BWAZCDOJBYJVFA-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|