C31H24N2O4S — CID 18904654
N-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 18904654) has the molecular formula C31H24N2O4S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18904654 |
| Molecular Formula | C31H24N2O4S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | N-[3-[2-oxo-2-(4-phenoxyanilino)-1-phenylethyl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(SC(C(=O)Nc2ccc(Oc3ccccc3)cc2)c2ccccc2)c1)c1ccco1 |
| InChI | InChI=1S/C31H24N2O4S/c34-30(28-15-8-20-36-28)33-24-11-7-14-27(21-24)38-29(22-9-3-1-4-10-22)31(35)32-23-16-18-26(19-17-23)37-25-12-5-2-6-13-25/h1-21,29H,(H,32,35)(H,33,34) |
| InChIKey | MOCYFVMOMZUQID-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |