C29H19F7N2O2S — CID 21171276
3-methyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide (PubChem CID 21171276) has the molecular formula C29H19F7N2O2S and a molecular weight of 592.54 g/mol. Its IUPAC name is 3-methyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide.
| Compound Name | 3-methyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 21171276 |
| Molecular Formula | C29H19F7N2O2S |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 3-methyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]benzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(SC(C(=O)Nc3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H19F7N2O2S/c1-15-6-5-9-17(14-15)27(39)37-18-10-12-19(13-11-18)41-26(16-7-3-2-4-8-16)28(40)38-25-23(32)21(30)20(29(34,35)36)22(31)24(25)33/h2-14,26H,1H3,(H,37,39)(H,38,40) |
| InChIKey | CHAKEFJBRIRRKH-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|