C27H23F7N2O2S — CID 21170650
3,3-dimethyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide (PubChem CID 21170650) has the molecular formula C27H23F7N2O2S and a molecular weight of 572.55 g/mol. Its IUPAC name is 3,3-dimethyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide |
|---|---|
| PubChem CID | 21170650 |
| Molecular Formula | C27H23F7N2O2S |
| Molecular Weight | 572.55 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 3,3-dimethyl-N-[4-[2-oxo-1-phenyl-2-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]ethyl]sulfanylphenyl]butanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(SC(C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H23F7N2O2S/c1-26(2,3)13-17(37)35-15-9-11-16(12-10-15)39-24(14-7-5-4-6-8-14)25(38)36-23-21(30)19(28)18(27(32,33)34)20(29)22(23)31/h4-12,24H,13H2,1-3H3,(H,35,37)(H,36,38) |
| InChIKey | BBWXPGRWRKGNJS-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.55 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|