C20H15F7N2O4S — CID 22786304
4-oxo-4-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]butanoic acid (PubChem CID 22786304) has the molecular formula C20H15F7N2O4S and a molecular weight of 512.40 g/mol. Its IUPAC name is 4-oxo-4-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]butanoic acid.
| Compound Name | 4-oxo-4-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]butanoic acid |
|---|---|
| PubChem CID | 22786304 |
| Molecular Formula | C20H15F7N2O4S |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 4-oxo-4-[4-[1-oxo-1-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)anilino]propan-2-yl]sulfanylanilino]butanoic acid |
| SMILES | CC(Sc1ccc(NC(=O)CCC(=O)O)cc1)C(=O)Nc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C20H15F7N2O4S/c1-8(34-10-4-2-9(3-5-10)28-11(30)6-7-12(31)32)19(33)29-18-16(23)14(21)13(20(25,26)27)15(22)17(18)24/h2-5,8H,6-7H2,1H3,(H,28,30)(H,29,33)(H,31,32) |
| InChIKey | DWKRBHVRBSZBKF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|